CAS 948-03-8 appears in our catalog under these names: Methyl 1-hydroxy-2-naphthoate, 95%, Methyl 1-hydroxy-2-naphthoate, Methyl 1-hydroxy-2-naphthoate, 98%, 98%, METHYL 1-HYDROXY-2-NAPHTHOATE, 98%. Offered by: Combi-blocks, Thermo Scientific (Acros), Chemat, Sigma-Aldrich, Fluorochem. Available pack sizes: 25g, 10g, 5g, 1g, 100mg, 250mg, 50g, 100g.
Methyl 1-hydroxynaphthalene-2-carboxylate (CAS 948-03-8) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: methyl 1-hydroxynaphthalene-2-carboxylate. InChIKey: HMIBDRSTVGFJPB-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | methyl 1-hydroxynaphthalene-2-carboxylate |
| InChIKey | HMIBDRSTVGFJPB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=CC=CC=C2C=C1)O |
Computed by PubChem (NCBI)