Products 95041-89-7
CAS 95041-89-7 appears in our catalog under these names: 3-(3-Fluorophenyl)-2-oxopropanoic acid, 98%, 3-(3-Fluorophenyl)-2-oxopropanoic acid, 3-(3-Fluorophenyl)-2-oxopropanoic acid, 97%, 97%, 3-(3-fluorophenyl)-2-hydroxyprop-2-enoic acid, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
3-(3-fluorophenyl)-2-oxopropanoic acid (CAS 95041-89-7) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: 3-(3-fluorophenyl)-2-oxopropanoic acid. InChIKey: GTMNJUMHHOHBIJ-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 3-(3-fluorophenyl)-2-oxopropanoic acid |
| InChIKey | GTMNJUMHHOHBIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CC(=O)C(=O)O |
Computed by PubChem (NCBI)