Products 950665-12-0
CAS 950665-12-0 is the registry number for FLDP-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3E,5E)-3,5-bis[(4-hydroxy-3-methoxyphenyl)methylidene]piperidin-4-one (CAS 950665-12-0) is a chemical compound with the molecular formula C21H21NO5 and a molecular weight of 367.4 g/mol. IUPAC name: (3E,5E)-3,5-bis[(4-hydroxy-3-methoxyphenyl)methylidene]piperidin-4-one. InChIKey: QKBRHSFMRAGHMJ-BGPOSVGRSA-N.
| Molecular formula | C21H21NO5 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (3E,5E)-3,5-bis[(4-hydroxy-3-methoxyphenyl)methylidene]piperidin-4-one |
| InChIKey | QKBRHSFMRAGHMJ-BGPOSVGRSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C\2/C(=O)/C(=C/C3=CC(=C(C=C3)O)OC)/CNC2)O |
Computed by PubChem (NCBI)