Products 952059-64-2
CAS 952059-64-2 is the registry number for 6-Methoxy-1,7-naphthyridin-4(1H)-one, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-methoxy-1H-1,7-naphthyridin-4-one (CAS 952059-64-2) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 6-methoxy-1H-1,7-naphthyridin-4-one. InChIKey: IZNOIEBRRPDYSG-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 6-methoxy-1H-1,7-naphthyridin-4-one |
| InChIKey | IZNOIEBRRPDYSG-UHFFFAOYSA-N |
| SMILES | COC1=NC=C2C(=C1)C(=O)C=CN2 |
Computed by PubChem (NCBI)