Products 952182-41-1

CAS 952182-41-1 is the registry number for Methyl thieno(3,2-b)pyridine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl thieno[3,2-b]pyridine-3-carboxylate (CAS 952182-41-1) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: methyl thieno[3,2-b]pyridine-3-carboxylate. InChIKey: VONXLZSDTMCDLP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7NO2S
Molecular weight193.22 g/mol
IUPAC namemethyl thieno[3,2-b]pyridine-3-carboxylate
InChIKeyVONXLZSDTMCDLP-UHFFFAOYSA-N
SMILESCOC(=O)C1=CSC2=C1N=CC=C2

Computed by PubChem (NCBI)