CAS 952285-52-8 appears in our catalog under these names: Methyl 4–amino–2,5–difluorobenzoate, Methyl 4-amino-2,5-difluorobenzoate 95%, Methyl 4-amino-2,5-difluorobenzoate, 95%, 95%, METHYL 4-AMINO-2,5-DIFLUOROBENZOATE, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 1g, 10g, 25g, 100g, 500g, 250mg.
Methyl 4-amino-2,5-difluorobenzoate (CAS 952285-52-8) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: methyl 4-amino-2,5-difluorobenzoate. InChIKey: WFHMJOPCOWABHH-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | methyl 4-amino-2,5-difluorobenzoate |
| InChIKey | WFHMJOPCOWABHH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1F)N)F |
Computed by PubChem (NCBI)