Products 952403-62-2
CAS 952403-62-2 appears in our catalog under these names: 4-(Trifluoromethyl)cubane-1-carboxylic acid, 98%, 4-(Trifluoromethyl)cubane-1-carboxylic acid 95%. Offered by: AmBeed. Available pack sizes: 1g, 10mg, 25mg, 50mg, 100mg, 250mg.
4-(trifluoromethyl)cubane-1-carboxylic acid (CAS 952403-62-2) is a chemical compound with the molecular formula C10H7F3O2 and a molecular weight of 216.16 g/mol. IUPAC name: 4-(trifluoromethyl)cubane-1-carboxylic acid. InChIKey: CSEJTSYWSALBDK-UHFFFAOYSA-N.
| Molecular formula | C10H7F3O2 |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | 4-(trifluoromethyl)cubane-1-carboxylic acid |
| InChIKey | CSEJTSYWSALBDK-UHFFFAOYSA-N |
| SMILES | C12C3C4C1(C5C2C3(C45)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)