CAS 952479-99-1 appears in our catalog under these names: Methyl 2,5-difluoro-3-methylbenzoate, 98%, 2,5-Difluoro-3-methylbenzoic acid methyl ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 1000mg, 500mg, 2000mg, 5000mg.
Methyl 2,5-difluoro-3-methylbenzoate (CAS 952479-99-1) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: methyl 2,5-difluoro-3-methylbenzoate. InChIKey: PEINXYFJYNQXAU-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | methyl 2,5-difluoro-3-methylbenzoate |
| InChIKey | PEINXYFJYNQXAU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)C(=O)OC)F |
Computed by PubChem (NCBI)