Products 954233-05-7
CAS 954233-05-7 appears in our catalog under these names: 2-Cyclopropyl-4-methylpyrimidine-5-carboxylic acid, 95%, 2-Cyclopropyl-4-methyl-pyrimidine-5-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2.5g.
2-cyclopropyl-4-methylpyrimidine-5-carboxylic acid (CAS 954233-05-7) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 2-cyclopropyl-4-methylpyrimidine-5-carboxylic acid. InChIKey: BSLXWOKIRNVYGN-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 2-cyclopropyl-4-methylpyrimidine-5-carboxylic acid |
| InChIKey | BSLXWOKIRNVYGN-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC=C1C(=O)O)C2CC2 |
Computed by PubChem (NCBI)