CAS 954269-40-0 appears in our catalog under these names: 1-(4-Amino-2,6-dichlorophenyl)pyrrolidin-2-one, 95%, 1-(4-Amino-2,6-dichlorophenyl)pyrrolidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(4-amino-2,6-dichlorophenyl)pyrrolidin-2-one (CAS 954269-40-0) is a chemical compound with the molecular formula C10H10Cl2N2O and a molecular weight of 245.10 g/mol. IUPAC name: 1-(4-amino-2,6-dichlorophenyl)pyrrolidin-2-one. InChIKey: YJIAUYQUFVLQMC-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2O |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 1-(4-amino-2,6-dichlorophenyl)pyrrolidin-2-one |
| InChIKey | YJIAUYQUFVLQMC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=C(C=C(C=C2Cl)N)Cl |
Computed by PubChem (NCBI)