CAS 1323699-63-3 appears in our catalog under these names: {(5-(4-Chlorophenyl)-3-isoxazolyl)methyl}amine hydrochloride, ([5-(4-Chlorophenyl)-3-isoxazolyl]methyl)amine hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,5g, 5g, 10g, 1g, 250mg.
[5-(4-chlorophenyl)-1,2-oxazol-3-yl]methanamine;hydrochloride (CAS 1323699-63-3) is a chemical compound with the molecular formula C10H10Cl2N2O and a molecular weight of 245.10 g/mol. IUPAC name: [5-(4-chlorophenyl)-1,2-oxazol-3-yl]methanamine;hydrochloride. InChIKey: MPIVHYLSCKPXBK-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2O |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | [5-(4-chlorophenyl)-1,2-oxazol-3-yl]methanamine;hydrochloride |
| InChIKey | MPIVHYLSCKPXBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NO2)CN)Cl.Cl |
Computed by PubChem (NCBI)