CAS 1160245-59-9 appears in our catalog under these names: ([5-(2-Chlorophenyl)-3-isoxazolyl]methyl)amine hydrochloride, 95%, (5-(2-Chlorophenyl)isoxazol-3-yl)methanamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 250mg, 5g.
[5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine;hydrochloride (CAS 1160245-59-9) is a chemical compound with the molecular formula C10H10Cl2N2O and a molecular weight of 245.10 g/mol. IUPAC name: [5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine;hydrochloride. InChIKey: WZZSRYJJKIDOMZ-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2O |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | [5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine;hydrochloride |
| InChIKey | WZZSRYJJKIDOMZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=NO2)CN)Cl.Cl |
Computed by PubChem (NCBI)