CAS 62675-32-5 is the registry number for 7,9-Dichloro-1-methyl-3,4-dihydro-1H-benzo[e][1,4]diazepin-5(2H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
7,9-dichloro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one (CAS 62675-32-5) is a chemical compound with the molecular formula C10H10Cl2N2O and a molecular weight of 245.10 g/mol. IUPAC name: 7,9-dichloro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one. InChIKey: AIGHHOYJELINIY-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2O |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 7,9-dichloro-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one |
| InChIKey | AIGHHOYJELINIY-UHFFFAOYSA-N |
| SMILES | CN1CCNC(=O)C2=C1C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)