CAS 1159826-68-2 appears in our catalog under these names: (3-(3-Chlorophenyl)isoxazol-5-yl)methanamine hydrochloride, 95%, (3-(3-Chlorophenyl)isoxazol-5-yl)methanamine hydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 50mg.
[3-(3-chlorophenyl)-1,2-oxazol-5-yl]methanamine;hydrochloride (CAS 1159826-68-2) is a chemical compound with the molecular formula C10H10Cl2N2O and a molecular weight of 245.10 g/mol. IUPAC name: [3-(3-chlorophenyl)-1,2-oxazol-5-yl]methanamine;hydrochloride. InChIKey: FBIANNIESMPANH-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2O |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | [3-(3-chlorophenyl)-1,2-oxazol-5-yl]methanamine;hydrochloride |
| InChIKey | FBIANNIESMPANH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NOC(=C2)CN.Cl |
Computed by PubChem (NCBI)