Products 2893971-41-8
CAS 2893971-41-8 is the registry number for 1',4'-Dichloro-7',8'-dihydro-5'H-spiro[oxetane-3,6'-phthalazine], 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-dichlorospiro[6,8-dihydro-5H-phthalazine-7,3'-oxetane] (CAS 2893971-41-8) is a chemical compound with the molecular formula C10H10Cl2N2O and a molecular weight of 245.10 g/mol. IUPAC name: 1,4-dichlorospiro[6,8-dihydro-5H-phthalazine-7,3'-oxetane]. InChIKey: YQFKMYFEALMASX-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2O |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 1,4-dichlorospiro[6,8-dihydro-5H-phthalazine-7,3'-oxetane] |
| InChIKey | YQFKMYFEALMASX-UHFFFAOYSA-N |
| SMILES | C1CC2(CC3=C1C(=NN=C3Cl)Cl)COC2 |
Computed by PubChem (NCBI)