CAS 2734062-35-0 is the registry number for 2,4-Dichloro-7-ethoxy-5,6-dihydroquinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-7-ethoxy-5,6-dihydroquinazoline (CAS 2734062-35-0) is a chemical compound with the molecular formula C10H10Cl2N2O and a molecular weight of 245.10 g/mol. IUPAC name: 2,4-dichloro-7-ethoxy-5,6-dihydroquinazoline. InChIKey: QLZAFRBBCOHLMC-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2O |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 2,4-dichloro-7-ethoxy-5,6-dihydroquinazoline |
| InChIKey | QLZAFRBBCOHLMC-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(CC1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)