CAS 1250985-49-9 appears in our catalog under these names: 3-Amino-1-(3,4-dichlorophenyl)pyrrolidin-2-one, 98%, 3-Amino-1-(3,4-dichlorophenyl)pyrrolidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-amino-1-(3,4-dichlorophenyl)pyrrolidin-2-one (CAS 1250985-49-9) is a chemical compound with the molecular formula C10H10Cl2N2O and a molecular weight of 245.10 g/mol. IUPAC name: 3-amino-1-(3,4-dichlorophenyl)pyrrolidin-2-one. InChIKey: UHQDZBZXNKWKHF-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2O |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 3-amino-1-(3,4-dichlorophenyl)pyrrolidin-2-one |
| InChIKey | UHQDZBZXNKWKHF-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C1N)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)