CAS 959615-59-9 is the registry number for 7-Methoxy-1,5-naphthyridin-2(1H)-one. Offered by: TRC. Available pack sizes: 100mg.
7-methoxy-1H-1,5-naphthyridin-2-one (CAS 959615-59-9) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 7-methoxy-1H-1,5-naphthyridin-2-one. InChIKey: JIILCZQUUQHSEN-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 7-methoxy-1H-1,5-naphthyridin-2-one |
| InChIKey | JIILCZQUUQHSEN-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CC(=O)N2)N=C1 |
Computed by PubChem (NCBI)