CAS 96721-83-4 appears in our catalog under these names: N-(5-Phenylpyridin-2-yl)acetamide, 97%, N-Acetyl-2-amino-5-phenylpyridine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 1g.
N-(5-phenyl-2-pyridinyl)acetamide (CAS 96721-83-4) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: N-(5-phenyl-2-pyridinyl)acetamide. InChIKey: FXUKKQSINSXDFT-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | N-(5-phenyl-2-pyridinyl)acetamide |
| InChIKey | FXUKKQSINSXDFT-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)