CAS 98446-58-3 is the registry number for N-(2,4-Dibromo-5-hydroxyphenyl)acetamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
N-(2,4-dibromo-5-hydroxyphenyl)acetamide (CAS 98446-58-3) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: N-(2,4-dibromo-5-hydroxyphenyl)acetamide. InChIKey: DLSMHUQFBYTZRM-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | N-(2,4-dibromo-5-hydroxyphenyl)acetamide |
| InChIKey | DLSMHUQFBYTZRM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1Br)Br)O |
Computed by PubChem (NCBI)