CAS 98491-81-7 is the registry number for Nicotine Impurity 5 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxyethyl pyridine-3-carboxylate;hydrochloride (CAS 98491-81-7) is a chemical compound with the molecular formula C8H10ClNO3 and a molecular weight of 203.62 g/mol. IUPAC name: 2-hydroxyethyl pyridine-3-carboxylate;hydrochloride. InChIKey: YHFUISGUYGOUEV-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO3 |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | 2-hydroxyethyl pyridine-3-carboxylate;hydrochloride |
| InChIKey | YHFUISGUYGOUEV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)OCCO.Cl |
Computed by PubChem (NCBI)