Products 98515-98-1

CAS 98515-98-1 is the registry number for [cis-2-(acetoxymethyl)cyclobutyl]methyl acetate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

[(1S,2R)-2-(acetyloxymethyl)cyclobutyl]methyl acetate (CAS 98515-98-1) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: [(1S,2R)-2-(acetyloxymethyl)cyclobutyl]methyl acetate. InChIKey: FYXBCGVHUPQUPI-AOOOYVTPSA-N.

Identity
Molecular formulaC10H16O4
Molecular weight200.23 g/mol
IUPAC name[(1S,2R)-2-(acetyloxymethyl)cyclobutyl]methyl acetate
InChIKeyFYXBCGVHUPQUPI-AOOOYVTPSA-N
SMILESCC(=O)OC[C@H]1CC[C@H]1COC(=O)C

Computed by PubChem (NCBI)