CAS 98590-42-2 is the registry number for 2-(bromomethyl)-5-nitro-phenol acetate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
[2-(bromomethyl)-5-nitrophenyl] acetate (CAS 98590-42-2) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: [2-(bromomethyl)-5-nitrophenyl] acetate. InChIKey: SGFGJVMOMRHJQB-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | [2-(bromomethyl)-5-nitrophenyl] acetate |
| InChIKey | SGFGJVMOMRHJQB-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=CC(=C1)[N+](=O)[O-])CBr |
Computed by PubChem (NCBI)