Products 98640-00-7
CAS 98640-00-7 is the registry number for 2-(5,6-dichloro-1H-indol-3-yl)acetic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(5,6-dichloro-1H-indol-3-yl)acetic acid (CAS 98640-00-7) is a chemical compound with the molecular formula C10H7Cl2NO2 and a molecular weight of 244.07 g/mol. IUPAC name: 2-(5,6-dichloro-1H-indol-3-yl)acetic acid. InChIKey: ICRDKUKLLAPFGP-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO2 |
|---|---|
| Molecular weight | 244.07 g/mol |
| IUPAC name | 2-(5,6-dichloro-1H-indol-3-yl)acetic acid |
| InChIKey | ICRDKUKLLAPFGP-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)NC=C2CC(=O)O |
Computed by PubChem (NCBI)