Products 99066-64-5
CAS 99066-64-5 appears in our catalog under these names: 5-Iodo-1H-indole-2-carboxylic acid, 5-Iodo-1H-indole-2-carboxylic acid, 95%, 5-Iodo-1H-indole-2-carboxylic acid, 95%, 95%. Offered by: Chemat Brand, Biosynth, AmBeed, Chemat, Fluorochem. Available pack sizes: on request, 50mg, 0,5g, 1g, 100mg, 250mg, 500mg.
5-iodo-1H-indole-2-carboxylic acid (CAS 99066-64-5) is a chemical compound with the molecular formula C9H6INO2 and a molecular weight of 287.05 g/mol. IUPAC name: 5-iodo-1H-indole-2-carboxylic acid. InChIKey: VFNFKMFTFFMIRW-UHFFFAOYSA-N.
| Molecular formula | C9H6INO2 |
|---|---|
| Molecular weight | 287.05 g/mol |
| IUPAC name | 5-iodo-1H-indole-2-carboxylic acid |
| InChIKey | VFNFKMFTFFMIRW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)