CAS 99304-37-7 is the registry number for 5-Bromo-3-hydroxy-2-indolinone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-bromo-3-hydroxy-1,3-dihydroindol-2-one (CAS 99304-37-7) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 5-bromo-3-hydroxy-1,3-dihydroindol-2-one. InChIKey: MLPDUEVGLOZRJI-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 5-bromo-3-hydroxy-1,3-dihydroindol-2-one |
| InChIKey | MLPDUEVGLOZRJI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(C(=O)N2)O |
Computed by PubChem (NCBI)