CAS 99321-71-8 is the registry number for 2-Methoxy-3,4-dimethyl-1-nitrobenzene, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-methoxy-1,2-dimethyl-4-nitrobenzene (CAS 99321-71-8) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 3-methoxy-1,2-dimethyl-4-nitrobenzene. InChIKey: IPKDBYLJNSVQCY-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 3-methoxy-1,2-dimethyl-4-nitrobenzene |
| InChIKey | IPKDBYLJNSVQCY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)[N+](=O)[O-])OC)C |
Computed by PubChem (NCBI)