CAS 99462-32-5 appears in our catalog under these names: Milrinone Impurity 1, Milrinone Impurity 14, 1,6-Dihydro-2-(hydroxymethyl)-6-oxo-(3,4'-bipyridine)-5-carbonitrile. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
6-(hydroxymethyl)-2-oxo-5-pyridin-4-yl-1H-pyridine-3-carbonitrile (CAS 99462-32-5) is a chemical compound with the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. IUPAC name: 6-(hydroxymethyl)-2-oxo-5-pyridin-4-yl-1H-pyridine-3-carbonitrile. InChIKey: JMDVFNJHUBQULS-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 6-(hydroxymethyl)-2-oxo-5-pyridin-4-yl-1H-pyridine-3-carbonitrile |
| InChIKey | JMDVFNJHUBQULS-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=C(NC(=O)C(=C2)C#N)CO |
Computed by PubChem (NCBI)