Products 99768-12-4
CAS 99768-12-4 appears in our catalog under these names: 4-METHOXYCARBONYLPHENYLBORONIC ACID, >=, 4-(Methoxycarbonyl)phenylboronic Acid, 4-Methoxycarbonylphenylboronic acid/ 95+%, Methyl 4-boronobenzoate 98%, Methyl 4-boronobenzoate, 99.96%. Offered by: Sigma-Aldrich, TRC, Chemat, Ambeed, MedChemExpress. Available pack sizes: 1G, 5G, 10g, 25g, 100g, 500g, 1000g, 10mM/1mL.
(4-methoxycarbonylphenyl)boronic acid (CAS 99768-12-4) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: (4-methoxycarbonylphenyl)boronic acid. InChIKey: PQCXFUXRTRESBD-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | (4-methoxycarbonylphenyl)boronic acid |
| InChIKey | PQCXFUXRTRESBD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Methoxycarbonylphenylboronic acid, 4-(Methoxycarbonyl)phenylboronic acid, Methyl 4-boronobenzoate, (4-(Methoxycarbonyl)phenyl)boronic acid, (4-Methoxycarbonylphenyl)boronic acid, 4-(Methoxycarbonyl)benzeneboronic Acid, [4-(methoxycarbonyl)phenyl]boronic acid, 4-(methoxycabonyl)phenylboronic acid, 4-carbomethoxyphenylboronic acid, p-(methoxycarbonyl)phenylboronic acid