CAS 99817-29-5 appears in our catalog under these names: 4-(3,4-Dichlorophenyl)-1,2,5-oxadiazol-3-amine, 95%, 4-(3,4-Dichlorophenyl)-1,2,5-oxadiazol-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(3,4-dichlorophenyl)-1,2,5-oxadiazol-3-amine (CAS 99817-29-5) is a chemical compound with the molecular formula C8H5Cl2N3O and a molecular weight of 230.05 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)-1,2,5-oxadiazol-3-amine. InChIKey: PABLAQMULABYGS-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3O |
|---|---|
| Molecular weight | 230.05 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)-1,2,5-oxadiazol-3-amine |
| InChIKey | PABLAQMULABYGS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NON=C2N)Cl)Cl |
Computed by PubChem (NCBI)