Products 99853-28-8
CAS 99853-28-8 is the registry number for p-Bromophenacyl Lactate. Offered by: TRC. Available pack sizes: 2,5g.
[2-(4-bromophenyl)-2-oxoethyl] 2-hydroxypropanoate (CAS 99853-28-8) is a chemical compound with the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. IUPAC name: [2-(4-bromophenyl)-2-oxoethyl] 2-hydroxypropanoate. InChIKey: OBXSUTQDQHWMOH-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO4 |
|---|---|
| Molecular weight | 287.11 g/mol |
| IUPAC name | [2-(4-bromophenyl)-2-oxoethyl] 2-hydroxypropanoate |
| InChIKey | OBXSUTQDQHWMOH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)OCC(=O)C1=CC=C(C=C1)Br)O |
Computed by PubChem (NCBI)