CAS 175275-74-8 appears in our catalog under these names: Rel-(1R,2R)-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid, 95%, rel-(1R,2R)-2-(4-Fluorophenyl)cyclopropane-1-carboxylic acid, rel-(1R,2R)-2-(4-Fluorophenyl)cyclopropanecarboxylic acid, 96%, 96%, rel-(1R,2R)-2-(4-Fluorophenyl)cyclopropane-1-carboxylic acid, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 5g, 100mg.
Trans-(1R,2R)-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 175275-74-8) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: trans-(1R,2R)-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: QJJWMUZHTDQZDW-DTWKUNHWSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | QJJWMUZHTDQZDW-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)