cas: 1379444-89-9 — see every product listed under this CAS number, including other names
tert-Butyl (R)-2-aminopentanoate hydrochloride, 98% (CAS 1379444-89-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1944171-5g |
| cas | 1379444-89-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7178.92 Pln | |
| AmBeed | 10g | 10902.64 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl (2R)-2-aminopentanoate;hydrochloride (CAS 1379444-89-9) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: tert-butyl (2R)-2-aminopentanoate;hydrochloride. InChIKey: YQHANSSYWITJHA-OGFXRTJISA-N.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | tert-butyl (2R)-2-aminopentanoate;hydrochloride |
| InChIKey | YQHANSSYWITJHA-OGFXRTJISA-N |
| SMILES | CCC[C@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)