cas: 1280786-59-5 — see every product listed under this CAS number, including other names
tert-Butyl 6-chloropicolinate, 96%, 96% (CAS 1280786-59-5) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111XQP-100g |
| cas | 1280786-59-5 |
| size | 100g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 10283.60 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 914.00 Pln | |
| Chemat | 10g | 1658.00 Pln | |
| Chemat | 25g | 3256.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 6-chloropyridine-2-carboxylate (CAS 1280786-59-5) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: tert-butyl 6-chloropyridine-2-carboxylate. InChIKey: DVPHJLOQDYBPAW-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | tert-butyl 6-chloropyridine-2-carboxylate |
| InChIKey | DVPHJLOQDYBPAW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=NC(=CC=C1)Cl |
Computed by PubChem (NCBI)