Products 1280786-59-5
CAS 1280786-59-5 appears in our catalog under these names: tert-Butyl 6-chloropicolinate, 96%, tert-Butyl 6-chloropicolinate, 95-<97%, tert-Butyl 6-chloropicolinate, ≥97-<99%, tert-Butyl 6-chloropicolinate, tert-Butyl 6-chloropicolinate 96%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 5g, 1g, 25g, 50g, 100g, 200g, 300g.
Tert-butyl 6-chloropyridine-2-carboxylate (CAS 1280786-59-5) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: tert-butyl 6-chloropyridine-2-carboxylate. InChIKey: DVPHJLOQDYBPAW-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | tert-butyl 6-chloropyridine-2-carboxylate |
| InChIKey | DVPHJLOQDYBPAW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=NC(=CC=C1)Cl |
Computed by PubChem (NCBI)