cas: 219503-74-9 — see every product listed under this CAS number, including other names
tert-Butyl 6-nitro-1H-indazole-1-carboxylate 97% (CAS 219503-74-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A213250-1g |
| cas | 219503-74-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 264.69 Pln | |
| Ambeed | 5g | 743.06 Pln | |
| Ambeed | 10g | 1199.19 Pln | |
| Ambeed | 25g | 2333.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A213250 |
Tert-butyl 6-nitroindazole-1-carboxylate (CAS 219503-74-9) is a chemical compound with the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. IUPAC name: tert-butyl 6-nitroindazole-1-carboxylate. InChIKey: IDQFCHKQFNYMFE-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O4 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | tert-butyl 6-nitroindazole-1-carboxylate |
| InChIKey | IDQFCHKQFNYMFE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=CC(=C2)[N+](=O)[O-])C=N1 |
Computed by PubChem (NCBI)