cas: 106402-41-9 — see every product listed under this CAS number, including other names
tert-Butyl L-serinate hydrochloride, 98%, 98% (CAS 106402-41-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ABC-100mg |
| cas | 106402-41-9 |
| size | 100mg |
| availability | 300g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 366.80 Pln | |
| Chemat | 10g | 669.20 Pln | |
| Chemat | 25g | 1571.60 Pln | |
| Chemat | 100g | 6107.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride (CAS 106402-41-9) is a chemical compound with the molecular formula C7H16ClNO3 and a molecular weight of 197.66 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride. InChIKey: TUDHOGYHZNNYHW-JEDNCBNOSA-N.
| Molecular formula | C7H16ClNO3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride |
| InChIKey | TUDHOGYHZNNYHW-JEDNCBNOSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)