tert-Butyl piperidine-3-carboxylate, 97%
cas: 301180-05-2 — see every product listed under this CAS number, including other names
tert-Butyl piperidine-3-carboxylate, 97% (CAS 301180-05-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A571146-100mg |
| cas | 301180-05-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 342.56 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1227.00 Pln | |
| Ambeed | 5g | 4141.75 Pln | |
| Ambeed | 10g | 7401.38 Pln | |
| Fluorochem | 250mg | 664.37 Pln | |
| Fluorochem | 1g | 1580.71 Pln | |
| Fluorochem | 5g | 7099.60 Pln | |
| Fluorochem | 10g | 12722.62 Pln | |
| BLDpharm | 100mg | 342.13 Pln | |
| BLDpharm | 250mg | 508.73 Pln | |
| BLDpharm | 1g | 1208.49 Pln | |
| BLDpharm | 5g | 4063.04 Pln | |
| BLDpharm | 10g | 7261.91 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl piperidine-3-carboxylate;hydrochloride (CAS 301180-05-2) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: tert-butyl piperidine-3-carboxylate;hydrochloride. InChIKey: FNTUZXRGYYMCBP-UHFFFAOYSA-N.
| Molecular formula | C10H20ClNO2 |
|---|---|
| Molecular weight | 221.72 g/mol |
| IUPAC name | tert-butyl piperidine-3-carboxylate;hydrochloride |
| InChIKey | FNTUZXRGYYMCBP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CCCNC1.Cl |
Computed by PubChem (NCBI)