cas: 889858-12-2 — see every product listed under this CAS number, including other names
tert-butyl 4-bromo-2-fluorobenzoate 98% (CAS 889858-12-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A107995-1g |
| cas | 889858-12-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 275.81 Pln | |
| Ambeed | 25g | 531.69 Pln | |
| Ambeed | 100g | 1043.44 Pln | |
| Ambeed | 500g | 3969.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A107995 |
Tert-butyl 4-bromo-2-fluorobenzoate (CAS 889858-12-2) is a chemical compound with the molecular formula C11H12BrFO2 and a molecular weight of 275.11 g/mol. IUPAC name: tert-butyl 4-bromo-2-fluorobenzoate. InChIKey: ZPGZHSAOCVWZMR-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO2 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | tert-butyl 4-bromo-2-fluorobenzoate |
| InChIKey | ZPGZHSAOCVWZMR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)