cas: 27687-14-5 — see every product listed under this CAS number, including other names
trans-4-(tert-Butoxycarbonylaminomethyl)cyclohexanecarboxylic Acid, 98%, 98% (CAS 27687-14-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113UGP-1g |
| cas | 27687-14-5 |
| size | 1g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 165.20 Pln | |
| Chemat | 25g | 270.80 Pln | |
| Chemat | 50g | 438.80 Pln | |
| Chemat | 100g | 750.80 Pln | |
| Chemat | 500g | 1339.20 Pln | |
| Chemat | 1kg | 2498.00 Pln | |
| Chemat | 5kg | 11908.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid (CAS 27687-14-5) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid. InChIKey: AZEKNJGFCSHZID-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid |
| InChIKey | AZEKNJGFCSHZID-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(CC1)C(=O)O |
Computed by PubChem (NCBI)