CAS 1284228-59-6 is the registry number for (+/-)-Trans-4-(3-chloro-phenyl)-pyrrolidine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
(3S,4R)-4-(3-chlorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1284228-59-6) is a chemical compound with the molecular formula C11H13Cl2NO2 and a molecular weight of 262.13 g/mol. IUPAC name: (3S,4R)-4-(3-chlorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: IEHHOWWTGGDVRO-BAUSSPIASA-N.
| Molecular formula | C11H13Cl2NO2 |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | (3S,4R)-4-(3-chlorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | IEHHOWWTGGDVRO-BAUSSPIASA-N |
| SMILES | C1[C@H]([C@@H](CN1)C(=O)O)C2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)