cas: 565456-77-1 — see every product listed under this CAS number, including other names
(1R,2S,5S)-Methyl 6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate Hydrochloride, 99%, 99% (CAS 565456-77-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IA4E-100mg |
| cas | 565456-77-1 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 69.20 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 10g | 213.20 Pln | |
| Chemat | 25g | 390.80 Pln | |
| Chemat | 50g | 650.00 Pln | |
| Chemat | 100g | 1096.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Methyl (1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate;hydrochloride (CAS 565456-77-1) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: methyl (1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate;hydrochloride. InChIKey: FKVUDBWXNAFSPB-MKXDVQRUSA-N.
| Molecular formula | C9H16ClNO2 |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | methyl (1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate;hydrochloride |
| InChIKey | FKVUDBWXNAFSPB-MKXDVQRUSA-N |
| SMILES | CC1([C@@H]2[C@H]1[C@H](NC2)C(=O)OC)C.Cl |
Computed by PubChem (NCBI)