CAS 956004-47-0 appears in our catalog under these names: Methyl 6,6-dimethyl-3-azabicyclo(3.1.0)hexane-2-carboxylate hydrochloride, 97%, Methyl 6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g.
Methyl 6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate;hydrochloride (CAS 956004-47-0) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: methyl 6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate;hydrochloride. InChIKey: FKVUDBWXNAFSPB-UHFFFAOYSA-N.
| Molecular formula | C9H16ClNO2 |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | methyl 6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate;hydrochloride |
| InChIKey | FKVUDBWXNAFSPB-UHFFFAOYSA-N |
| SMILES | CC1(C2C1C(NC2)C(=O)OC)C.Cl |
Computed by PubChem (NCBI)