CAS 2925068-67-1 is the registry number for Methyl (1S,2S,5R)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl (1S,2S,5R)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate;hydrochloride (CAS 2925068-67-1) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: methyl (1S,2S,5R)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate;hydrochloride. InChIKey: FKVUDBWXNAFSPB-IXUZKAFRSA-N.
| Molecular formula | C9H16ClNO2 |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | methyl (1S,2S,5R)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate;hydrochloride |
| InChIKey | FKVUDBWXNAFSPB-IXUZKAFRSA-N |
| SMILES | CC1([C@H]2[C@@H]1[C@H](NC2)C(=O)OC)C.Cl |
Computed by PubChem (NCBI)