cas: 21963-41-7 — see every product listed under this CAS number, including other names
(1S,2S)-1,2-Cyclohexanedicarboxylic Acid, >98.0%(GC)(T) (CAS 21963-41-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C1954-1G |
| cas | 21963-41-7 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 216.69 Pln | |
| TCI | 5g | 969.03 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
Trans-(1S,2S)-cyclohexane-1,2-dicarboxylic acid (CAS 21963-41-7) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: trans-(1S,2S)-cyclohexane-1,2-dicarboxylic acid. InChIKey: QSAWQNUELGIYBC-WDSKDSINSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | trans-(1S,2S)-cyclohexane-1,2-dicarboxylic acid |
| InChIKey | QSAWQNUELGIYBC-WDSKDSINSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)