cas: 21963-41-7 — see every product listed under this CAS number, including other names
(1S,2S)-Cyclohexane-1,2-Dicarboxylic Acid, 98%, 98% (CAS 21963-41-7) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BIW-1kg |
| cas | 21963-41-7 |
| size | 1kg |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 4360.40 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 203.60 Pln | |
| Chemat | 100g | 573.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Trans-(1S,2S)-cyclohexane-1,2-dicarboxylic acid (CAS 21963-41-7) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: trans-(1S,2S)-cyclohexane-1,2-dicarboxylic acid. InChIKey: QSAWQNUELGIYBC-WDSKDSINSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | trans-(1S,2S)-cyclohexane-1,2-dicarboxylic acid |
| InChIKey | QSAWQNUELGIYBC-WDSKDSINSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)