cas: 96443-42-4 — see every product listed under this CAS number, including other names
(1S,3R)-3-(Methoxycarbonyl)cyclopentanecarboxylic acid 95% (CAS 96443-42-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A158264-250mg |
| cas | 96443-42-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 392.62 Pln | |
| Ambeed | 1g | 798.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A158264 |
Cis-(1S,3R)-3-methoxycarbonylcyclopentane-1-carboxylic acid (CAS 96443-42-4) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: cis-(1S,3R)-3-methoxycarbonylcyclopentane-1-carboxylic acid. InChIKey: FVUHGTQDOMGZOT-NTSWFWBYSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | cis-(1S,3R)-3-methoxycarbonylcyclopentane-1-carboxylic acid |
| InChIKey | FVUHGTQDOMGZOT-NTSWFWBYSA-N |
| SMILES | COC(=O)[C@@H]1CC[C@@H](C1)C(=O)O |
Computed by PubChem (NCBI)