CAS 111138-52-4 is the registry number for (1S,3S)-3-(Methoxycarbonyl)cyclopentane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1S,3S)-3-methoxycarbonylcyclopentane-1-carboxylic acid (CAS 111138-52-4) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: trans-(1S,3S)-3-methoxycarbonylcyclopentane-1-carboxylic acid. InChIKey: FVUHGTQDOMGZOT-WDSKDSINSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | trans-(1S,3S)-3-methoxycarbonylcyclopentane-1-carboxylic acid |
| InChIKey | FVUHGTQDOMGZOT-WDSKDSINSA-N |
| SMILES | COC(=O)[C@H]1CC[C@@H](C1)C(=O)O |
Computed by PubChem (NCBI)