cas: 518357-42-1 — see every product listed under this CAS number, including other names
(2'-Chloro-[1,1'-biphenyl]-4-yl)methanamine hydrochloride, 97%, 97% (CAS 518357-42-1) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D9JA-10mg |
| cas | 518357-42-1 |
| size | 10mg |
| availability | 0.025g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 266.00 Pln | |
| Chemat | 25mg | 400.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[4-(2-chlorophenyl)phenyl]methanamine;hydrochloride (CAS 518357-42-1) is a chemical compound with the molecular formula C13H13Cl2N and a molecular weight of 254.15 g/mol. IUPAC name: [4-(2-chlorophenyl)phenyl]methanamine;hydrochloride. InChIKey: URGRCECNVGEABW-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2N |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | [4-(2-chlorophenyl)phenyl]methanamine;hydrochloride |
| InChIKey | URGRCECNVGEABW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)CN)Cl.Cl |
Computed by PubChem (NCBI)