CAS 5267-37-8 appears in our catalog under these names: (3-Chlorophenyl)(phenyl)methanamine hydrochloride, 95%, (3-Chlorophenyl)(phenyl)methanamine hydrochloride, (3-Chlorophenyl)(phenyl)methanamine hydrochloride 98%, (3-Chlorophenyl)(phenyl)methanamine hydrochloride, 98%, 98%, (3-Chlorophenyl)(phenyl)methanamine hydrochloride, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 5g, 100mg, 25g.
(3-chlorophenyl)-phenylmethanamine;hydrochloride (CAS 5267-37-8) is a chemical compound with the molecular formula C13H13Cl2N and a molecular weight of 254.15 g/mol. IUPAC name: (3-chlorophenyl)-phenylmethanamine;hydrochloride. InChIKey: UCOACANPNQMECK-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2N |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | (3-chlorophenyl)-phenylmethanamine;hydrochloride |
| InChIKey | UCOACANPNQMECK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=CC=C2)Cl)N.Cl |
Computed by PubChem (NCBI)